CAS 152241-12-8 is the registry number for 1-Bromo-4-(difluoro(phenyl)methyl)benzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g.
1-bromo-4-[difluoro(phenyl)methyl]benzene (CAS 152241-12-8) is a chemical compound with the molecular formula C13H9BrF2 and a molecular weight of 283.11 g/mol. IUPAC name: 1-bromo-4-[difluoro(phenyl)methyl]benzene. InChIKey: VASYSKDNWCMWPT-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | 1-bromo-4-[difluoro(phenyl)methyl]benzene |
| InChIKey | VASYSKDNWCMWPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Br)(F)F |
Computed by PubChem (NCBI)