CAS 2734773-96-5 is the registry number for 4-Bromo-2,5-difluoro-2'-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-2,5-difluoro-4-(2-methylphenyl)benzene (CAS 2734773-96-5) is a chemical compound with the molecular formula C13H9BrF2 and a molecular weight of 283.11 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-(2-methylphenyl)benzene. InChIKey: AAOBMXITXIUCNV-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-(2-methylphenyl)benzene |
| InChIKey | AAOBMXITXIUCNV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)