Products 1248278-90-1
CAS 1248278-90-1 is the registry number for 4-(Bromo(phenyl)methyl)-1,2-difluorobenzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[bromo(phenyl)methyl]-1,2-difluorobenzene (CAS 1248278-90-1) is a chemical compound with the molecular formula C13H9BrF2 and a molecular weight of 283.11 g/mol. IUPAC name: 4-[bromo(phenyl)methyl]-1,2-difluorobenzene. InChIKey: PKLJGOAIDLCXEP-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | 4-[bromo(phenyl)methyl]-1,2-difluorobenzene |
| InChIKey | PKLJGOAIDLCXEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)F)F)Br |
Computed by PubChem (NCBI)