CAS 1071959-03-9 is the registry number for Benzoic acid, 3-(acetylamino)-5-borono-, 1-methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-acetamido-5-methoxycarbonylphenyl)boronic acid (CAS 1071959-03-9) is a chemical compound with the molecular formula C10H12BNO5 and a molecular weight of 237.02 g/mol. IUPAC name: (3-acetamido-5-methoxycarbonylphenyl)boronic acid. InChIKey: QZHAMNSNXSJPQI-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO5 |
|---|---|
| Molecular weight | 237.02 g/mol |
| IUPAC name | (3-acetamido-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | QZHAMNSNXSJPQI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)NC(=O)C)C(=O)OC)(O)O |
Computed by PubChem (NCBI)