CAS 480424-95-1 appears in our catalog under these names: N-(4-Phenylboronic)-succinamic acid/ 95+%, N–(4–Phenylboronic)succinamic acid(contains varying amounts of Anhydride), 4-((4-Boronophenyl)amino)-4-oxobutanoic acid, 98%, 98%, N-[4-Phenylboronic]-succinamic acid, 97%, 4-((4-Boronophenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(4-boronoanilino)-4-oxobutanoic acid (CAS 480424-95-1) is a chemical compound with the molecular formula C10H12BNO5 and a molecular weight of 237.02 g/mol. IUPAC name: 4-(4-boronoanilino)-4-oxobutanoic acid. InChIKey: VYUCUZOJUHAJLU-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO5 |
|---|---|
| Molecular weight | 237.02 g/mol |
| IUPAC name | 4-(4-boronoanilino)-4-oxobutanoic acid |
| InChIKey | VYUCUZOJUHAJLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)CCC(=O)O)(O)O |
Computed by PubChem (NCBI)