Products 2024542-05-8
CAS 2024542-05-8 appears in our catalog under these names: 3-(4-Boronobenzamido)propanoic acid, 97%, 97%, 3-{[4-(Dihydroxyboranyl)phenyl]formamido}propanoic acid, 3-{[4-(Dihydroxyboranyl)phenyl]formamido}propanoic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, Get quote.
3-[(4-boronobenzoyl)amino]propanoic acid (CAS 2024542-05-8) is a chemical compound with the molecular formula C10H12BNO5 and a molecular weight of 237.02 g/mol. IUPAC name: 3-[(4-boronobenzoyl)amino]propanoic acid. InChIKey: JNYSFQLWGQUIEV-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO5 |
|---|---|
| Molecular weight | 237.02 g/mol |
| IUPAC name | 3-[(4-boronobenzoyl)amino]propanoic acid |
| InChIKey | JNYSFQLWGQUIEV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCC(=O)O)(O)O |
Computed by PubChem (NCBI)