CAS 31754-00-4 appears in our catalog under these names: 3-(3-Carboxypropionylamino)phenylboronic acid, 98%, 3-(3-Carboxypropionylamino)phenylboronic acid, 98%, 98%, 3-(3-Carboxypropionylamino)phenylboronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 250mg.
4-(3-boronoanilino)-4-oxobutanoic acid (CAS 31754-00-4) is a chemical compound with the molecular formula C10H12BNO5 and a molecular weight of 237.02 g/mol. IUPAC name: 4-(3-boronoanilino)-4-oxobutanoic acid. InChIKey: SVHXAKJLLKGJGC-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO5 |
|---|---|
| Molecular weight | 237.02 g/mol |
| IUPAC name | 4-(3-boronoanilino)-4-oxobutanoic acid |
| InChIKey | SVHXAKJLLKGJGC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)CCC(=O)O)(O)O |
Computed by PubChem (NCBI)