CAS 107228-57-9 is the registry number for 3,6–dichloro–4–cyclobutylpyridazine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3,6-dichloro-4-cyclobutylpyridazine (CAS 107228-57-9) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 3,6-dichloro-4-cyclobutylpyridazine. InChIKey: BHWXGEUPWBHWGS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 3,6-dichloro-4-cyclobutylpyridazine |
| InChIKey | BHWXGEUPWBHWGS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)