CAS 107265-16-7 appears in our catalog under these names: 4'-Hydroxy Fenoprofen, 4-Hyroxy Fenoprofen. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
2-[3-(4-hydroxyphenoxy)phenyl]propanoic acid (CAS 107265-16-7) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2-[3-(4-hydroxyphenoxy)phenyl]propanoic acid. InChIKey: RIGQDHFDPVTTEV-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-[3-(4-hydroxyphenoxy)phenyl]propanoic acid |
| InChIKey | RIGQDHFDPVTTEV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)OC2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)