CAS 107269-65-8 appears in our catalog under these names: (1-Phenyl-1h-1,2,3,4-tetrazol-5-yl)methanamine hydrochloride, 95%, (1-Phenyl-1H-1,2,3,4-tetrazol-5-yl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
(1-phenyltetrazol-5-yl)methanamine (CAS 107269-65-8) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: (1-phenyltetrazol-5-yl)methanamine. InChIKey: FYVSPIVYFAYMIZ-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | (1-phenyltetrazol-5-yl)methanamine |
| InChIKey | FYVSPIVYFAYMIZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=N2)CN |
Computed by PubChem (NCBI)