CAS 31694-91-4 appears in our catalog under these names: 2-Benzyl-2h-1,2,3,4-tetrazol-5-amine, 95%, 2–Benzyl–2H–1,2,3,4–tetrazol–5–amine, 2-benzyl-2H-1,2,3,4-tetrazol-5-amine. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-benzyltetrazol-5-amine (CAS 31694-91-4) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: 2-benzyltetrazol-5-amine. InChIKey: SYWWVUJXAAINHI-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 2-benzyltetrazol-5-amine |
| InChIKey | SYWWVUJXAAINHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2N=C(N=N2)N |
Computed by PubChem (NCBI)