CAS 933715-97-0 is the registry number for (5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methanamine (CAS 933715-97-0) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: (3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methanamine. InChIKey: ADERNRNIBQILBJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | (3-pyridin-2-yl-1H-1,2,4-triazol-5-yl)methanamine |
| InChIKey | ADERNRNIBQILBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NNC(=N2)CN |
Computed by PubChem (NCBI)