CAS 3310-68-7 appears in our catalog under these names: N3-Phenyl-1h-1,2,4-triazole-3,5-diamine, 95%, N3-Phenyl-1H-1,2,4-triazole-3,5-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-N-phenyl-1H-1,2,4-triazole-3,5-diamine (CAS 3310-68-7) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: 3-N-phenyl-1H-1,2,4-triazole-3,5-diamine. InChIKey: SFXBTXYONCDQJY-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 3-N-phenyl-1H-1,2,4-triazole-3,5-diamine |
| InChIKey | SFXBTXYONCDQJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NNC(=N2)N |
Computed by PubChem (NCBI)