Products 1072944-82-1
CAS 1072944-82-1 is the registry number for 5-Amino-4-cyano-1-(2,4-dimethylphenyl)-3-methylpyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-amino-1-(2,4-dimethylphenyl)-3-methylpyrazole-4-carbonitrile (CAS 1072944-82-1) is a chemical compound with the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. IUPAC name: 5-amino-1-(2,4-dimethylphenyl)-3-methylpyrazole-4-carbonitrile. InChIKey: QVKVGGICIOTHOU-UHFFFAOYSA-N.
| Molecular formula | C13H14N4 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | 5-amino-1-(2,4-dimethylphenyl)-3-methylpyrazole-4-carbonitrile |
| InChIKey | QVKVGGICIOTHOU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=C(C(=N2)C)C#N)N)C |
Computed by PubChem (NCBI)