CAS 1393442-44-8 is the registry number for 1-Cyclohexyl-1,2,3-benzotriazole-5-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-cyclohexylbenzotriazole-5-carbonitrile (CAS 1393442-44-8) is a chemical compound with the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. IUPAC name: 1-cyclohexylbenzotriazole-5-carbonitrile. InChIKey: MJOUMNCIFSQQHC-UHFFFAOYSA-N.
| Molecular formula | C13H14N4 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | 1-cyclohexylbenzotriazole-5-carbonitrile |
| InChIKey | MJOUMNCIFSQQHC-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C3=C(C=C(C=C3)C#N)N=N2 |
Computed by PubChem (NCBI)