CAS 109473-24-7 is the registry number for 3-(isopropyl)indeno(2,3-d)pyrazol-4-hydrazone. Offered by: Biosynth. Available pack sizes: 250mg.
(3-propan-2-yl-1,2-dihydroindeno[1,2-c]pyrazol-4-yl)diazene (CAS 109473-24-7) is a chemical compound with the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. IUPAC name: (3-propan-2-yl-1,2-dihydroindeno[1,2-c]pyrazol-4-yl)diazene. InChIKey: UWHVBVWNPFZOGD-UHFFFAOYSA-N.
| Molecular formula | C13H14N4 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | (3-propan-2-yl-1,2-dihydroindeno[1,2-c]pyrazol-4-yl)diazene |
| InChIKey | UWHVBVWNPFZOGD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=C3C=CC=CC3=C2N=N)NN1 |
Computed by PubChem (NCBI)