CAS 1152951-06-8 is the registry number for 4-((4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)methyl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-amino-3,5-dimethylpyrazol-1-yl)methyl]benzonitrile (CAS 1152951-06-8) is a chemical compound with the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. IUPAC name: 4-[(4-amino-3,5-dimethylpyrazol-1-yl)methyl]benzonitrile. InChIKey: VHCQKOGQLCEHLB-UHFFFAOYSA-N.
| Molecular formula | C13H14N4 |
|---|---|
| Molecular weight | 226.28 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dimethylpyrazol-1-yl)methyl]benzonitrile |
| InChIKey | VHCQKOGQLCEHLB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(C=C2)C#N)C)N |
Computed by PubChem (NCBI)