CAS 850568-02-4 appears in our catalog under these names: (2–(Aminomethyl)–4–fluorophenyl)boronic acid hydrochloride, (2-(Aminomethyl)-4-fluorophenyl)boronic acid hydrochloride, 98%, Boronic acid, B-[2-(aminomethyl)-4-fluorophenyl]-, hydrochloride (1:1), 98%, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[2-(aminomethyl)-4-fluorophenyl]boronic acid;hydrochloride (CAS 850568-02-4) is a chemical compound with the molecular formula C7H10BClFNO2 and a molecular weight of 205.42 g/mol. IUPAC name: [2-(aminomethyl)-4-fluorophenyl]boronic acid;hydrochloride. InChIKey: IWBXNXDYMQDTHO-UHFFFAOYSA-N.
| Molecular formula | C7H10BClFNO2 |
|---|---|
| Molecular weight | 205.42 g/mol |
| IUPAC name | [2-(aminomethyl)-4-fluorophenyl]boronic acid;hydrochloride |
| InChIKey | IWBXNXDYMQDTHO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)CN)(O)O.Cl |
Computed by PubChem (NCBI)