CAS 1073255-46-5 is the registry number for 2-Chlorophenyl Cyclopentyl-d9 Ketone. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
(2-chlorophenyl)-(1,2,2,3,3,4,4,5,5-nonadeuteriocyclopentyl)methanone (CAS 1073255-46-5) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 217.74 g/mol. IUPAC name: (2-chlorophenyl)-(1,2,2,3,3,4,4,5,5-nonadeuteriocyclopentyl)methanone. InChIKey: QIJMMRNZBJHXRI-WHSZNIRESA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 217.74 g/mol |
| IUPAC name | (2-chlorophenyl)-(1,2,2,3,3,4,4,5,5-nonadeuteriocyclopentyl)methanone |
| InChIKey | QIJMMRNZBJHXRI-WHSZNIRESA-N |
| SMILES | [2H]C1(C(C(C(C1([2H])[2H])([2H])C(=O)C2=CC=CC=C2Cl)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)