CAS 1073354-84-3 appears in our catalog under these names: 2-Hydroxypyrimidine-5-boronic acid pinacol ester, 95%, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-ol, 98%, 2-Hydroxypyrimidine-5-boronic acid pinacol ester, 95% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-2-one (CAS 1073354-84-3) is a chemical compound with the molecular formula C10H15BN2O3 and a molecular weight of 222.05 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-2-one. InChIKey: JRCSRFGCQSLWNZ-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O3 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrimidin-2-one |
| InChIKey | JRCSRFGCQSLWNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC(=O)N=C2 |
Computed by PubChem (NCBI)