Products 2246815-87-0
CAS 2246815-87-0 appears in our catalog under these names: (4-((3,3-Dimethylureido)methyl)phenyl)boronic acid, 98%, (4–((3，3–dimethylureido)methyl)phenyl)boronic acid, (4-((3，3-dimethylureido)methyl)phenyl)boronic acid, 95%, 95%, (4-((3,3-DIMETHYLUREIDO)METHYL)PHENYL)BORONIC ACID, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg.
[4-[(dimethylcarbamoylamino)methyl]phenyl]boronic acid (CAS 2246815-87-0) is a chemical compound with the molecular formula C10H15BN2O3 and a molecular weight of 222.05 g/mol. IUPAC name: [4-[(dimethylcarbamoylamino)methyl]phenyl]boronic acid. InChIKey: FXIHHVWYZCFQNK-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O3 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [4-[(dimethylcarbamoylamino)methyl]phenyl]boronic acid |
| InChIKey | FXIHHVWYZCFQNK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)