CAS 2256708-73-1 is the registry number for (2–hydroxy–6–(piperidin–2–yl)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
(2-oxo-6-piperidin-2-yl-1H-pyridin-4-yl)boronic acid (CAS 2256708-73-1) is a chemical compound with the molecular formula C10H15BN2O3 and a molecular weight of 222.05 g/mol. IUPAC name: (2-oxo-6-piperidin-2-yl-1H-pyridin-4-yl)boronic acid. InChIKey: BHFTXYQDHKLZHJ-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O3 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | (2-oxo-6-piperidin-2-yl-1H-pyridin-4-yl)boronic acid |
| InChIKey | BHFTXYQDHKLZHJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=O)NC(=C1)C2CCCCN2)(O)O |
Computed by PubChem (NCBI)