CAS 1287752-89-9 appears in our catalog under these names: (6-[(2,2-Dimethylpropanoyl)amino]-3-pyridinyl)boronic acid, 95%, (6-Pivalamidopyridin-3-yl)boronic acid, 95+%, (6-(2,2-Dimethylpropanamido)pyridin-3-yl)boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g.
[6-(2,2-dimethylpropanoylamino)-3-pyridinyl]boronic acid (CAS 1287752-89-9) is a chemical compound with the molecular formula C10H15BN2O3 and a molecular weight of 222.05 g/mol. IUPAC name: [6-(2,2-dimethylpropanoylamino)-3-pyridinyl]boronic acid. InChIKey: UMNSJQDICLTXBG-UHFFFAOYSA-N.
| Molecular formula | C10H15BN2O3 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [6-(2,2-dimethylpropanoylamino)-3-pyridinyl]boronic acid |
| InChIKey | UMNSJQDICLTXBG-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)