Products 1073485-56-9
CAS 1073485-56-9 is the registry number for 4-{[(3-nitrophenyl)methane]sulfonyl}morpholine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[(3-nitrophenyl)methylsulfonyl]morpholine (CAS 1073485-56-9) is a chemical compound with the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. IUPAC name: 4-[(3-nitrophenyl)methylsulfonyl]morpholine. InChIKey: TYDFPGBWBYTSHS-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 4-[(3-nitrophenyl)methylsulfonyl]morpholine |
| InChIKey | TYDFPGBWBYTSHS-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)