CAS 36212-66-5 is the registry number for Tos-asn-oh, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2S)-4-amino-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoic acid (CAS 36212-66-5) is a chemical compound with the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. IUPAC name: (2S)-4-amino-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoic acid. InChIKey: VZCCSZRICJFBSI-VIFPVBQESA-N.
| Molecular formula | C11H14N2O5S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | (2S)-4-amino-2-[(4-methylphenyl)sulfonylamino]-4-oxobutanoic acid |
| InChIKey | VZCCSZRICJFBSI-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)