CAS 65194-68-5 appears in our catalog under these names: 2-Morpholino-5-sulfamoylbenzoic acid, 98%, 2-(Morpholin-4-yl)-5-sulfamoylbenzoic acid, 5-(Aminosulfonyl)-2-morpholin-4-ylbenzoic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 2,5g, 250mg, 1g, 100mg.
2-morpholin-4-yl-5-sulfamoylbenzoic acid (CAS 65194-68-5) is a chemical compound with the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. IUPAC name: 2-morpholin-4-yl-5-sulfamoylbenzoic acid. InChIKey: DMFZVEPUUJLDTA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 2-morpholin-4-yl-5-sulfamoylbenzoic acid |
| InChIKey | DMFZVEPUUJLDTA-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)