CAS 7478-88-8 appears in our catalog under these names: N-([4-(Acetylamino)phenyl]sulfonyl)-beta-alanine, 95%, 3-(4-Acetamidophenylsulfonamido)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(4-acetamidophenyl)sulfonylamino]propanoic acid (CAS 7478-88-8) is a chemical compound with the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. IUPAC name: 3-[(4-acetamidophenyl)sulfonylamino]propanoic acid. InChIKey: WJPNHFVXBVQRJG-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5S |
|---|---|
| Molecular weight | 286.31 g/mol |
| IUPAC name | 3-[(4-acetamidophenyl)sulfonylamino]propanoic acid |
| InChIKey | WJPNHFVXBVQRJG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)