CAS 1073494-25-3 is the registry number for (4-Bromo-3-trifluoromethyl-phenyl)-morpholin-4-yl-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-bromo-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone (CAS 1073494-25-3) is a chemical compound with the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. IUPAC name: [4-bromo-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone. InChIKey: ZAXXFAXGBVNGPB-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF3NO2 |
|---|---|
| Molecular weight | 338.12 g/mol |
| IUPAC name | [4-bromo-3-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone |
| InChIKey | ZAXXFAXGBVNGPB-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)