CAS 1607296-68-3 appears in our catalog under these names: 4-[4-Bromo-2-(trifluoromethyl)benzoyl]morpholine, 95%, 4-(4-Bromo-2-(trifluoromethyl)benzoyl)morpholine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
[4-bromo-2-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone (CAS 1607296-68-3) is a chemical compound with the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. IUPAC name: [4-bromo-2-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone. InChIKey: LGCLNGSOULXHEN-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF3NO2 |
|---|---|
| Molecular weight | 338.12 g/mol |
| IUPAC name | [4-bromo-2-(trifluoromethyl)phenyl]-morpholin-4-ylmethanone |
| InChIKey | LGCLNGSOULXHEN-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=C(C=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)