CAS 2270910-58-0 is the registry number for 5-Bromo-n-cyclopropyl-2-(2,2,2-trifluoro-ethoxy)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-bromo-N-cyclopropyl-2-(2,2,2-trifluoroethoxy)benzamide (CAS 2270910-58-0) is a chemical compound with the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. IUPAC name: 5-bromo-N-cyclopropyl-2-(2,2,2-trifluoroethoxy)benzamide. InChIKey: HJRDCVSQQOGOLA-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF3NO2 |
|---|---|
| Molecular weight | 338.12 g/mol |
| IUPAC name | 5-bromo-N-cyclopropyl-2-(2,2,2-trifluoroethoxy)benzamide |
| InChIKey | HJRDCVSQQOGOLA-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=C(C=CC(=C2)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)