Products 2340391-46-8
CAS 2340391-46-8 is the registry number for 6-Bromo-8-methoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1(2H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-8-methoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one (CAS 2340391-46-8) is a chemical compound with the molecular formula C12H11BrF3NO2 and a molecular weight of 338.12 g/mol. IUPAC name: 6-bromo-8-methoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one. InChIKey: YBRNSKGDXMGUQV-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF3NO2 |
|---|---|
| Molecular weight | 338.12 g/mol |
| IUPAC name | 6-bromo-8-methoxy-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one |
| InChIKey | YBRNSKGDXMGUQV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)N(CC2)CC(F)(F)F)Br |
Computed by PubChem (NCBI)