CAS 107484-68-4 appears in our catalog under these names: 8-Iodo-1,6-naphthyridin-5(6H)-one, 98%, 8-iodo-1,6-naphthyridin-5(6H)-one. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
8-iodo-6H-1,6-naphthyridin-5-one (CAS 107484-68-4) is a chemical compound with the molecular formula C8H5IN2O and a molecular weight of 272.04 g/mol. IUPAC name: 8-iodo-6H-1,6-naphthyridin-5-one. InChIKey: KZJKEVXOGXRXCX-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | 8-iodo-6H-1,6-naphthyridin-5-one |
| InChIKey | KZJKEVXOGXRXCX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CNC2=O)I)N=C1 |
Computed by PubChem (NCBI)