CAS 944904-44-3 is the registry number for 3-Iodo-1h-indazole-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-iodo-2H-indazole-4-carbaldehyde (CAS 944904-44-3) is a chemical compound with the molecular formula C8H5IN2O and a molecular weight of 272.04 g/mol. IUPAC name: 3-iodo-2H-indazole-4-carbaldehyde. InChIKey: HCOJHJDJQPXOCX-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | 3-iodo-2H-indazole-4-carbaldehyde |
| InChIKey | HCOJHJDJQPXOCX-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C(=C1)C=O)I |
Computed by PubChem (NCBI)