CAS 82452-98-0 appears in our catalog under these names: 3-Iodo-1h-cinnolin-4-one, 95%, 3-Iodo-cinnolin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-iodo-1H-cinnolin-4-one (CAS 82452-98-0) is a chemical compound with the molecular formula C8H5IN2O and a molecular weight of 272.04 g/mol. IUPAC name: 3-iodo-1H-cinnolin-4-one. InChIKey: RKZBITNHZWXBIH-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | 3-iodo-1H-cinnolin-4-one |
| InChIKey | RKZBITNHZWXBIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=NN2)I |
Computed by PubChem (NCBI)