CAS 1363405-29-1 appears in our catalog under these names: 5-Iodo-1,7-naphthyridin-8(7h)-one, 95%, 5-Iodo-1,7-naphthyridin-8(7H)-one, 97%, 5–IODO–1,7–NAPHTHYRIDIN–8(7H)–ONE, 5-Iodo-1,7-naphthyridin-8(7H)-one. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
5-iodo-7H-1,7-naphthyridin-8-one (CAS 1363405-29-1) is a chemical compound with the molecular formula C8H5IN2O and a molecular weight of 272.04 g/mol. IUPAC name: 5-iodo-7H-1,7-naphthyridin-8-one. InChIKey: ZOBLPSZOJDYXDX-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | 5-iodo-7H-1,7-naphthyridin-8-one |
| InChIKey | ZOBLPSZOJDYXDX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)NC=C2I)N=C1 |
Computed by PubChem (NCBI)