Products 1075250-77-9
CAS 1075250-77-9 appears in our catalog under these names: Ergoline-8Beta-carboxylic Acid Methyl Ester Hydrochloride, Ergoline-8β-carboxylic acid methyl ester hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 5mg, 25mg, 1mg, 10mg, 50mg.
Methyl (6aR,9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride (CAS 1075250-77-9) is a chemical compound with the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. IUPAC name: methyl (6aR,9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride. InChIKey: MNGVCYYSNDLSFI-SRVRJAHMSA-N.
| Molecular formula | C16H19ClN2O2 |
|---|---|
| Molecular weight | 306.79 g/mol |
| IUPAC name | methyl (6aR,9R,10aR)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxylate;hydrochloride |
| InChIKey | MNGVCYYSNDLSFI-SRVRJAHMSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H]2[C@@H](CC3=CNC4=CC=CC2=C34)NC1.Cl |
Computed by PubChem (NCBI)