CAS 2251731-97-0 is the registry number for tert-Butyl 8-chloro-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 8-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (CAS 2251731-97-0) is a chemical compound with the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. IUPAC name: tert-butyl 8-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate. InChIKey: BVWJQEMIRNIJLP-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O2 |
|---|---|
| Molecular weight | 306.79 g/mol |
| IUPAC name | tert-butyl 8-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| InChIKey | BVWJQEMIRNIJLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)NC3=C2C=CC=C3Cl |
Computed by PubChem (NCBI)