Products 1256285-70-7
CAS 1256285-70-7 appears in our catalog under these names: Carbinoxamine N-Oxide, Carbinoxamine Impurity 3. Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(4-chlorophenyl)-pyridin-2-ylmethoxy]-N,N-dimethylethanamine oxide (CAS 1256285-70-7) is a chemical compound with the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. IUPAC name: 2-[(4-chlorophenyl)-pyridin-2-ylmethoxy]-N,N-dimethylethanamine oxide. InChIKey: QLXNLWWDYZYPSH-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O2 |
|---|---|
| Molecular weight | 306.79 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)-pyridin-2-ylmethoxy]-N,N-dimethylethanamine oxide |
| InChIKey | QLXNLWWDYZYPSH-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCOC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2)[O-] |
Computed by PubChem (NCBI)