Products 1987359-06-7

CAS 1987359-06-7 is the registry number for Methyl (1-benzylpiperidin-4-ylidene)(cyano)acetate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-(1-benzylpiperidin-4-ylidene)-2-cyanoacetate;hydrochloride (CAS 1987359-06-7) is a chemical compound with the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. IUPAC name: methyl 2-(1-benzylpiperidin-4-ylidene)-2-cyanoacetate;hydrochloride. InChIKey: OZKHHIMZCBHVOI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19ClN2O2
Molecular weight306.79 g/mol
IUPAC namemethyl 2-(1-benzylpiperidin-4-ylidene)-2-cyanoacetate;hydrochloride
InChIKeyOZKHHIMZCBHVOI-UHFFFAOYSA-N
SMILESCOC(=O)C(=C1CCN(CC1)CC2=CC=CC=C2)C#N.Cl

Computed by PubChem (NCBI)