Products 1075742-56-1
CAS 1075742-56-1 appears in our catalog under these names: ER ligand-10, ER ligand-10, 98%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: Get quote, 100mg, 250mg, 1g.
N,N-bis(4-hydroxyphenyl)acetamide (CAS 1075742-56-1) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: N,N-bis(4-hydroxyphenyl)acetamide. InChIKey: GPORWCRXAOCCFI-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | N,N-bis(4-hydroxyphenyl)acetamide |
| InChIKey | GPORWCRXAOCCFI-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)