Products 1076197-28-8

CAS 1076197-28-8 is the registry number for 5-Amino-4-cyano-1-phenyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

5-amino-4-cyano-1-phenylpyrazole-3-carboxylic acid (CAS 1076197-28-8) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 5-amino-4-cyano-1-phenylpyrazole-3-carboxylic acid. InChIKey: XYHLZNGGMFETLT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8N4O2
Molecular weight228.21 g/mol
IUPAC name5-amino-4-cyano-1-phenylpyrazole-3-carboxylic acid
InChIKeyXYHLZNGGMFETLT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=C(C(=N2)C(=O)O)C#N)N

Computed by PubChem (NCBI)