CAS 1076197-28-8 is the registry number for 5-Amino-4-cyano-1-phenyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 250mg, 500mg, 1000mg.
5-amino-4-cyano-1-phenylpyrazole-3-carboxylic acid (CAS 1076197-28-8) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 5-amino-4-cyano-1-phenylpyrazole-3-carboxylic acid. InChIKey: XYHLZNGGMFETLT-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 5-amino-4-cyano-1-phenylpyrazole-3-carboxylic acid |
| InChIKey | XYHLZNGGMFETLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(C(=N2)C(=O)O)C#N)N |
Computed by PubChem (NCBI)