CAS 95074-14-9 is the registry number for 2-((1H-1,2,4-Triazol-5-yl)methyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1H-1,2,4-triazol-5-ylmethyl)isoindole-1,3-dione (CAS 95074-14-9) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-ylmethyl)isoindole-1,3-dione. InChIKey: VOVUIRVWNBHONK-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazol-5-ylmethyl)isoindole-1,3-dione |
| InChIKey | VOVUIRVWNBHONK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=NC=NN3 |
Computed by PubChem (NCBI)