CAS 720718-34-3 is the registry number for 3-Methyl-4-pyridin-3-ylisoxazolo[3,4-d]pyridazin-7(6h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-methyl-4-pyridin-3-yl-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one (CAS 720718-34-3) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 3-methyl-4-pyridin-3-yl-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one. InChIKey: BCEQZGNPTCWTJR-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 3-methyl-4-pyridin-3-yl-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one |
| InChIKey | BCEQZGNPTCWTJR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NNC(=O)C2=NO1)C3=CN=CC=C3 |
Computed by PubChem (NCBI)