CAS 83692-82-4 appears in our catalog under these names: 6-Methyl-2-nitroimidazo[1,2-a:5,4-b']dipyridine, 98%, 2-Nitro-6-methyldipyrido(1,2-a:3',2'-d)imidazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
10-methyl-4-nitro-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene (CAS 83692-82-4) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 10-methyl-4-nitro-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene. InChIKey: MKGAVJXZBKHNNJ-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 10-methyl-4-nitro-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene |
| InChIKey | MKGAVJXZBKHNNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC3=C2N=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)