CAS 374067-80-8 is the registry number for 4-((4,6-Dihydroxy-2-pyrimidinyl)amino)benzonitrile. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]benzonitrile (CAS 374067-80-8) is a chemical compound with the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. IUPAC name: 4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]benzonitrile. InChIKey: HJFLUKUOXWTIBQ-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O2 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 4-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)amino]benzonitrile |
| InChIKey | HJFLUKUOXWTIBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)NC2=NC(=CC(=O)N2)O |
Computed by PubChem (NCBI)