CAS 1076199-85-3 appears in our catalog under these names: 7-Chloro-4-nitroquinoline, 97%, 7-Chloro-4-nitroquinoline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
7-chloro-4-nitroquinoline (CAS 1076199-85-3) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 7-chloro-4-nitroquinoline. InChIKey: DNMLUVBXPFQOKB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 7-chloro-4-nitroquinoline |
| InChIKey | DNMLUVBXPFQOKB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)