CAS 15166-26-4 appears in our catalog under these names: 4–Chloro–6–methyl–1,3–phenylenediisocyanate, 4-Chloro-6-methyl-m-phenylene diisocyanate, 95%, 4-Chloro-6-methyl-m-phenylene diisocyanate, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-chloro-2,4-diisocyanato-5-methylbenzene (CAS 15166-26-4) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 1-chloro-2,4-diisocyanato-5-methylbenzene. InChIKey: AULVDVFFHZBVDO-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 1-chloro-2,4-diisocyanato-5-methylbenzene |
| InChIKey | AULVDVFFHZBVDO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N=C=O)N=C=O)Cl |
Computed by PubChem (NCBI)