Products 29969-57-1
CAS 29969-57-1 appears in our catalog under these names: 2-Chloro-6-nitroquinoline, 95%, 2-chlor-6-nitro-chinolin, 95-<97%, 2-chlor-6-nitro-chinolin, ≥97-<99%, 2–chloro–6–nitroquinoline, 2-Chloro-6-nitroquinoline 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g, 25g, 50g, 100mg.
2-chloro-6-nitroquinoline (CAS 29969-57-1) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 2-chloro-6-nitroquinoline. InChIKey: FQYXTVZGTFWRGD-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 2-chloro-6-nitroquinoline |
| InChIKey | FQYXTVZGTFWRGD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Cl)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)