Products 944902-11-8

CAS 944902-11-8 appears in our catalog under these names: 2-Chloroquinazoline-4-carboxylic acid, 95%, 2-Chloro-4-quinazolinecarboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg, 500mg.

Structural formula: {0} (CAS {1})

2-chloroquinazoline-4-carboxylic acid (CAS 944902-11-8) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 2-chloroquinazoline-4-carboxylic acid. InChIKey: FPZJKAIFJVJOIS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClN2O2
Molecular weight208.60 g/mol
IUPAC name2-chloroquinazoline-4-carboxylic acid
InChIKeyFPZJKAIFJVJOIS-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NC(=N2)Cl)C(=O)O

Computed by PubChem (NCBI)