CAS 278610-39-2 appears in our catalog under these names: N-(2-Chloropyridin-3-yl)maleimide, 95%, 1-(2-Chloropyridin-3-yl)-1H-pyrrole-2,5-dione, 98%, 98%, 1-(2-Chloropyridin-3-yl)-1H-pyrrole-2,5-dione. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
1-(2-chloro-3-pyridinyl)pyrrole-2,5-dione (CAS 278610-39-2) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 1-(2-chloro-3-pyridinyl)pyrrole-2,5-dione. InChIKey: JVJJPDZQLVCNFU-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 1-(2-chloro-3-pyridinyl)pyrrole-2,5-dione |
| InChIKey | JVJJPDZQLVCNFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)